5-Acetylthiophene-2-carboxylic acid
- Product Name5-Acetylthiophene-2-carboxylic acid
- CAS4066-41-5
- MFC7H6O3S
- MW170.19
- EINECS609-857-0
- MOL File4066-41-5.mol
Chemical Properties
| Melting point | 210-212°C |
| Boiling point | 385.2±27.0 °C(Predicted) |
| Density | 1.383 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.95±0.10(Predicted) |
| color | White to Yellow |
| BRN | 128897 |
| InChI | InChI=1S/C7H6O3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3H,1H3,(H,9,10) |
| InChIKey | LIKIMWYKJUFVJP-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)SC(C(C)=O)=CC=1 |
| CAS DataBase Reference | 4066-41-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39-36 |
| Hazard Note | Irritant |
| HS Code | 2934999090 |
