Chloromethyltriisopropoxysilane 96
- Product NameChloromethyltriisopropoxysilane 96
- CAS18162-82-8
- MFC10H23ClO3Si
- MW254.83
- EINECS200-258-5
- MOL File18162-82-8.mol
Chemical Properties
| Boiling point | 195-198°C |
| Density | 0.962 g/mL at 25 °C (lit.) |
| refractive index | 1.4145 |
| Flash point | 181 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| Specific Gravity | 0.9836 |
| Appearance | Colorless to off-white Liquid |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C10H23ClO3Si/c1-8(2)12-15(7-11,13-9(3)4)14-10(5)6/h8-10H,7H2,1-6H3 |
| InChIKey | SAKYAANYXZKYEK-UHFFFAOYSA-N |
| SMILES | CC(C)O[Si](CCl)(OC(C)C)OC(C)C |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-36 |
| RIDADR | UN 3334 |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |