Chenodeoxycholic acid sodium
- Product NameChenodeoxycholic acid sodium
- CAS2646-38-0
- MFC24H41NaO4
- MW416.58
- EINECS
- MOL File2646-38-0.mol
Chemical Properties
| Melting point | 298 °C(dec.) |
| storage temp. | +15C to +30C |
| solubility | DMF: 3 mg/mL; DMSO: 10 mg/mL; Ethanol: 1 mg/mL; PBS (pH 7.2): 0.5 mg/mL |
| form | A solid |
| color | White to off-white |
| Water Solubility | water: 20mg/mL aqueous buffer: soluble |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - MISCELLANEOUS |
| InChIKey | WANBNZVOEKGHSS-OHXJQDLJNA-N |
| SMILES | C[C@]12CC[C@]3([H])[C@]4(CC[C@@H](O)C[C@@]4([H])C[C@@H](O)[C@@]3([H])[C@]1([H])CC[C@]2([H])[C@H](C)CCC(=O)O)C.[NaH] |&1:1,4,6,9,12,15,17,19,23,25,r| |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| RTECS | FZ2231000 |
| HS Code | 29181990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Repr. 2 |