4-(Fluorosulfonyl)benzoyl chloride

Chemical Properties

Melting point	46-48 °C (lit.)
Boiling point	96-97 °C/0.7 mmHg (lit.)
Density	1.5278 (estimate)
Stability	Stable, but hydrolyzes in water to generate acidic gas which can react with metals (and thereby generate flammable hydrogen gas). Incompatible with water, alcohols, strong bases, oxidizing agents.
InChI	1S/C7H4ClFO3S/c8-7(10)5-1-3-6(4-2-5)13(9,11)12/h1-4H
InChIKey	JMTAYFNTRRLWQG-UHFFFAOYSA-N
SMILES	FS(=O)(=O)c1ccc(cc1)C(Cl)=O

Hazard Codes	C
Risk Statements	34-36/37-22
Safety Statements	26-27-28-36/37/39-45
RIDADR	UN 3261 8/PG 2
WGK Germany	3
HazardClass	8
PackingGroup	III
Storage Class	8A - Combustible corrosive hazardous materials
Hazard Classifications	Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B STOT SE 3