| Boiling point |
100 °C/0.5 mmHg (lit.) |
| Density |
0.999 g/mL at 25 °C (lit.) |
| vapor pressure |
0.133Pa at 20℃ |
| refractive index |
n20/D 1.518(lit.) |
| Flash point |
>230 °F |
| solubility |
soluble in Methanol |
| form |
Liquid |
| Specific Gravity |
1.000 |
| color |
Colorless to Almost colorless |
| InChI |
1S/C13H16O2/c1-5-15-12(14)10-6-8-11(9-7-10)13(2,3)4/h5-9H,1H2,2-4H3 |
| InChIKey |
ZLHVSEPPILCZHH-UHFFFAOYSA-N |
| SMILES |
CC(C)(C)c1ccc(cc1)C(=O)OC=C |
| LogP |
3.94 at 25℃ and pH7 |
| Surface tension |
31.9mN/m at 1g/L and 20℃ |
| CAS DataBase Reference |
15484-80-7(CAS DataBase Reference) |
