Allyltriphenyltin
- Product NameAllyltriphenyltin
- CAS76-63-1
- MFC21H20Sn
- MW391.09
- EINECS200-975-4
- MOL File76-63-1.mol
Chemical Properties
| Melting point | 71-74 °C(lit.) |
| Boiling point | 421.4±38.0 °C(Predicted) |
| Density | 1,07 g/cm3 |
| Flash point | >100 |
| Water Solubility | Insoluble in water |
| form | solid |
| color | White to Almost white |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 3612762 |
| InChI | 1S/3C6H5.C3H5.Sn/c3*1-2-4-6-5-3-1;1-3-2;/h3*1-5H;3H,1-2H2; |
| InChIKey | NDUYAGLANMHJHF-UHFFFAOYSA-N |
| SMILES | C=CC[Sn](c1ccccc1)(c2ccccc2)c3ccccc3 |
| CAS DataBase Reference | 76-63-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-50/53 |
| Safety Statements | 26-27-28-45-60-61 |
| RIDADR | UN 3146 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | WH6705000 |
| TSCA | No |
| HS Code | 2931.90.6000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |