Chemical Properties
| Melting point | >300 °C(lit.) |
| Boiling point | 291.7°C |
| Density | 2.3110 |
| refractive index | 1.6400 (estimate) |
| storage temp. | room temp |
| pka | 0.92±0.25(Predicted) |
| form | Powder or Crystals |
| color | Yellow |
| Water Solubility | Soluble in water and ethanol. |
| BRN | 2043130 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C5H2O5/c6-1-2(7)4(9)5(10)3(1)8/h6-7H |
| InChIKey | RBSLJAJQOVYTRQ-UHFFFAOYSA-N |
| SMILES | C1(=O)C(O)=C(O)C(=O)C1=O |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HS Code | 29144000 |
| Storage Class | 11 - Combustible Solids |
