1,2-Dibromo-1,2-diphenylethane
- Product Name1,2-Dibromo-1,2-diphenylethane
- CAS13440-24-9
- MFC14H12Br2
- MW340.05
- EINECS635-052-9
- MOL File13440-24-9.mol
Chemical Properties
| Melting point | 241 °C (dec.)(lit.) |
| Boiling point | 323.8±37.0 °C(Predicted) |
| Density | 1.613±0.06 g/cm3(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 2050820 |
| InChI | 1S/C14H12Br2/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14+ |
| InChIKey | GKESIQQTGWVOLH-OKILXGFUSA-N |
| SMILES | Br[C@H]([C@H](Br)c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 13440-24-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 2903.99.8001 |
| HazardClass | 8 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |
