alpha,alpha'-Bis(4-hydroxyphenyl)-1,4-diisopropylbenzene
- Product Namealpha,alpha'-Bis(4-hydroxyphenyl)-1,4-diisopropylbenzene
- CAS2167-51-3
- MFC24H26O2
- MW346.46
- EINECS200-258-5
- MOL File2167-51-3.mol
Chemical Properties
| Melting point | 193-195 °C(lit.) |
| Boiling point | 246 °C(Press: 0.1 Torr) |
| Density | 1.107±0.06 g/cm3(Predicted) |
| solubility | very faint turbidity in Methanol |
| pka | 10.31±0.10(Predicted) |
| color | White to Almost white |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C24H26O2/c1-23(2,19-9-13-21(25)14-10-19)17-5-7-18(8-6-17)24(3,4)20-11-15-22(26)16-12-20/h5-16,25-26H,1-4H3 |
| InChIKey | GIXXQTYGFOHYPT-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c2ccc(cc2)C(C)(C)c3ccc(O)cc3 |
| CAS DataBase Reference | 2167-51-3 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29072990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |