TEBUTAM
- Product NameTEBUTAM
- CAS35256-85-0
- MFC15H23NO
- MW233.35
- EINECS252-470-3
- MOL File35256-85-0.mol
Chemical Properties
| Melting point | <25℃ |
| Boiling point | 96 °C |
| Density | 0.961±0.06 g/cm3(Predicted) |
| Flash point | 80 °C |
| storage temp. | Refrigerator |
| solubility | Chloroform, Methanol |
| pka | -0.50±0.70(Predicted) |
| color | Yellow |
| BRN | 2838127 |
| Henry's Law Constant | 3.8×101 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| Major Application | agriculture environmental |
| InChI | 1S/C15H23NO/c1-12(2)16(14(17)15(3,4)5)11-13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3 |
| InChIKey | RJKCKKDSSSRYCB-UHFFFAOYSA-N |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C(C)(C)C |
| EPA Substance Registry System | Butam (35256-85-0) |
Safety Information
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 2 |
| RTECS | UE3152000 |
| HS Code | 29242990 |
| Storage Class | 10 - Combustible liquids |
| Toxicity | guinea pig,LD50,oral,2025mg/kg (2025mg/kg),"Agrochemicals Handbook," with updates, Hartley, D., and H. Kidd, eds., Nottingham, Royal Soc of Chemistry, 1983-86Vol. A444, Pg. 1985, |
