2-Fluoro-4-hydroxybenzonitrile
- Product Name2-Fluoro-4-hydroxybenzonitrile
- CAS82380-18-5
- MFC7H4FNO
- MW137.11
- EINECS422-810-7
- MOL File82380-18-5.mol
Chemical Properties
| Melting point | 123-125 °C (lit.) |
| Boiling point | 285.4±25.0 °C(Predicted) |
| Density | 1,45 g/cm3 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | 4.7g/l |
| form | powder to crystal |
| pka | 6.84±0.18(Predicted) |
| color | White to Almost white |
| PH | 4.2 (H2O, 20℃)(saturated aqueous solution) |
| BRN | 4741066 |
| InChI | InChI=1S/C7H4FNO/c8-7-3-6(10)2-1-5(7)4-9/h1-3,10H |
| InChIKey | REIVHYDACHXPNH-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(O)C=C1F |
| CAS DataBase Reference | 82380-18-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | 3276 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Dam. 1 |