5-Azidopentanoic acid
- Product Name5-Azidopentanoic acid
- CAS79583-98-5
- MFC5H9N3O2
- MW143.145
- EINECS
- MOL File79583-98-5.mol
Chemical Properties
| Boiling point | 85°C/0.01mmHg(lit.) |
| Density | 1.142 |
| refractive index | 1.4640-1.4680 |
| storage temp. | -20°C |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | clear liquid |
| color | Colorless to Red to Green |
| BRN | 1706398 |
| InChI | InChI=1S/C5H9N3O2/c6-8-7-4-2-1-3-5(9)10/h1-4H2,(H,9,10) |
| InChIKey | SBZDIRMBQJDCLB-UHFFFAOYSA-N |
| SMILES | C(C(O)=O)CCCN=[N+]=[N-] |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HS Code | 29299090 |
| Storage Class | 5.2 - Organic peroxides and self-reacting hazardous materials |
| Hazard Classifications | Carc. 1B Self-react. C |
