4'-(2-Methylpropyl)acetophenone
- Product Name4'-(2-Methylpropyl)acetophenone
- CAS38861-78-8
- MFC12H16O
- MW176.25
- EINECS254-159-8
- MOL File38861-78-8.mol
Chemical Properties
| Boiling point | 134-135°C 16mm |
| Density | 0,952 g/cm3 |
| vapor pressure | 0.75Pa at 20℃ |
| refractive index | 1.5180 |
| Flash point | 54°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Dichloromethane; Diethyl Ether; Ethyl Acetate; THF |
| color | Colorless to Yellow |
| Water Solubility | Miscible with chloroform and methanol. Slightly miscible with water. |
| BRN | 1935275 |
| InChI | InChI=1S/C12H16O/c1-9(2)8-11-4-6-12(7-5-11)10(3)13/h4-7,9H,8H2,1-3H3 |
| InChIKey | KEAGRYYGYWZVPC-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(CC(C)C)C=C1)C |
| LogP | 3.4 at 23℃ |
| CAS DataBase Reference | 38861-78-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 4'-(2-Methylpropyl)acetophenone(38861-78-8) |
| EPA Substance Registry System | Ethanone, 1-[4-(2-methylpropyl)phenyl]- (38861-78-8) |
Safety Information
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 10-40-52/53-43 |
| Safety Statements | 16-36-22-61-36/37 |
| RIDADR | 1224 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29143990 |
