Chemical Properties
| Melting point | 99 °C |
| Boiling point | 570.8±50.0 °C(Predicted) |
| Density | 1.323 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.97±0.10(Predicted) |
| color | White to Light yellow |
| optical activity | Consistent with structure |
| BRN | 6071009 |
| Major Application | peptide synthesis |
| InChI | 1S/C17H17NO5/c19-14-8-6-12(7-9-14)10-15(16(20)21)18-17(22)23-11-13-4-2-1-3-5-13/h1-9,15,19H,10-11H2,(H,18,22)(H,20,21)/t15-/m1/s1 |
| InChIKey | MCRMUCXATQAAMN-OAHLLOKOSA-N |
| SMILES | OC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)OCc2ccccc2 |
| CAS DataBase Reference | 64205-12-5(CAS DataBase Reference) |
