2,4-Dibromobenzoic acid
- Product Name2,4-Dibromobenzoic acid
- CAS611-00-7
- MFC7H4Br2O2
- MW279.91
- EINECS210-245-7
- MOL File611-00-7.mol
Chemical Properties
| Melting point | 171.0 to 175.0 °C |
| Boiling point | 336.6±32.0 °C(Predicted) |
| Density | 1.9661 (rough estimate) |
| refractive index | 1.4970 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.62±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H4Br2O2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H,10,11) |
| InChIKey | NAGGYODWMPFKJQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(Br)C=C1Br |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| HS Code | 29163990 |
