4-Azidophenacyl bromide
- Product Name4-Azidophenacyl bromide
- CAS57018-46-9
- MFC8H6BrN3O
- MW240.06
- EINECS260-519-5
- MOL File57018-46-9.mol
Chemical Properties
| Melting point | 64-65 °C |
| storage temp. | 2-8°C |
| solubility | methanol: 50 mg/mL |
| form | powder |
| color | yellow |
| BRN | 1961705 |
| Stability | Light, Temperature And Moisture Sensitive, Temperature and Moisture sensitive |
| InChI | 1S/C8H6BrN3O/c9-5-8(13)6-1-3-7(4-2-6)11-12-10/h1-4H,5H2 |
| InChIKey | LZJPDRANSVSGOR-UHFFFAOYSA-N |
| SMILES | BrCC(=O)c1ccc(cc1)N=[N+]=[N-] |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 11-34-42/43 |
| Safety Statements | 16-26-27-36/37/39-45 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| F | 4.5-8-10-19 |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29299090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Dam. 1 Flam. Sol. 1 Resp. Sens. 1 Skin Corr. 1B Skin Sens. 1 |