Hafnium trifluoromethanesulfonate
- Product NameHafnium trifluoromethanesulfonate
- CAS161337-67-3
- MFCHF3HfO3S
- MW328.56
- EINECS
- MOL File161337-67-3.mol
Chemical Properties
| Melting point | >350 °C(lit.) |
| Flash point | None |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Soluble in methyl cyanide, dicholomethane, dichloroethane, nitromethane, dioxane, terahydrofuran and toluene. |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Hygroscopic |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| InChI | 1S/4CHF3O3S.Hf/c4*2-1(3,4)8(5,6)7;/h4*(H,5,6,7);/q;;;;+4/p-4 |
| InChIKey | BQYMOILRPDTPPJ-UHFFFAOYSA-J |
| SMILES | FC(F)(F)S(=O)(=O)O[Hf](OS(=O)(=O)C(F)(F)F)(OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| CAS DataBase Reference | 161337-67-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1759 8/PG III |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |