| Melting point |
150°C |
| Boiling point |
465.9±14.0 °C(Predicted) |
| Density |
1.132±0.06 g/cm3(Predicted) |
| storage temp. |
-20°C Freezer |
| solubility |
DMF: 25 mg/ml; DMSO: 10 mg/ml; Ethanol: 10 mg/ml |
| form |
Solid |
| pka |
4.90±0.30(Predicted) |
| color |
White to off-white |
| BRN |
5568831 |
| Major Application |
forensics and toxicology
pharmaceutical (small molecule) |
| InChI |
1S/C19H22O2/c1-13(19(20)21)15-11-12-16(14-7-3-2-4-8-14)18-10-6-5-9-17(15)18/h5-6,9-14H,2-4,7-8H2,1H3,(H,20,21) |
| InChIKey |
VZUGVMQFWFVFBX-UHFFFAOYSA-N |
| SMILES |
CC(C(O)=O)c1ccc(C2CCCCC2)c3ccccc13 |
| EPA Substance Registry System |
1-Naphthaleneacetic acid, 4-cyclohexyl-.alpha.-methyl- (71109-09-6) |
