4,4'-Dimethoxybenzhydrylamine
- Product Name4,4'-Dimethoxybenzhydrylamine
- CAS19293-62-0
- MFC15H17NO2
- MW243.3
- EINECS
- MOL File19293-62-0.mol
Chemical Properties
| Melting point | 62°C |
| Boiling point | 391.9±42.0 °C(Predicted) |
| Density | 1.099±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 8.85±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C15H17NO2/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,15H,16H2,1-2H3 |
| InChIKey | HROGQYMZWGPHIB-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1)C(N)c2ccc(OC)cc2 |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-36/37/39-61 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |