1,4-Bis(1-methyl-1-hydroxyethyl)benzene
- Product Name1,4-Bis(1-methyl-1-hydroxyethyl)benzene
- CAS2948-46-1
- MFC12H18O2
- MW194.27
- EINECS220-964-8
- MOL File2948-46-1.mol
Chemical Properties
| Melting point | 144-146 °C (lit.) |
| Boiling point | 167-168 °C/12 mmHg (lit.) |
| Density | 1.0010 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| Flash point | 167-168°C/12mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 14.25±0.29(Predicted) |
| color | White to Light yellow |
| Water Solubility | Slightly Soluble in water (2.1 g/L) (25°C). |
| InChI | InChI=1S/C12H18O2/c1-11(2,13)9-5-7-10(8-6-9)12(3,4)14/h5-8,13-14H,1-4H3 |
| InChIKey | LEARFTRDZQQTDN-UHFFFAOYSA-N |
| SMILES | C(O)(C)(C)C1C=CC(C(O)(C)C)=CC=1 |
| CAS DataBase Reference | 2948-46-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Bis(2-hydroxy-2-propyl)benzene (2948-46-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2906290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 2948-46-1(Hazardous Substances Data) |
