Tenuazonic acid copper from alternaria a
- Product NameTenuazonic acid copper from alternaria a
- CAS610-88-8
- MFC10H15NO3
- MW197.23
- EINECS
- MOL File610-88-8.mol
Chemical Properties
| Melting point | 74.5°C |
| alpha | 20D -128° (c = 1.0 in methanol); -132 ± 2° (c = 0.5 in CHCl3) |
| Boiling point | bp0.035 117° |
| Density | 1.1575 (rough estimate) |
| refractive index | 1.5480 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.50±1.00(Predicted) |
| form | Solid |
| color | Light yellow to brown |
| BRN | 3589518 |
| Stability | Hygroscopic, Temperature Sensitive |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C10H15NO3/c1-4-5(2)8-9(13)7(6(3)12)10(14)11-8/h5,8,13H,4H2,1-3H3,(H,11,14)/t5-,8-/m0/s1 |
| InChIKey | CEIZFXOZIQNICU-XNCJUZBTSA-N |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)C(C(C)=O)=C1O |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UY7425000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29337900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |