5-Carboxy-2-chlorobenzeneboronic acid 98
- Product Name5-Carboxy-2-chlorobenzeneboronic acid 98
- CAS913835-75-3
- MFC7H6BClO4
- MW200.38
- EINECS
- MOL File913835-75-3.mol
Chemical Properties
| Melting point | 228-244 |
| Boiling point | 462.5±55.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.98±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C7H6BClO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11) |
| InChIKey | ZITWKFSVFMUWIE-UHFFFAOYSA-N |
| SMILES | OB(C1=CC(C(O)=O)=CC=C1Cl)O |
| CAS DataBase Reference | 913835-75-3 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |