Benzophenone-4,4'-dicarboxylic acid
- Product NameBenzophenone-4,4'-dicarboxylic acid
- CAS964-68-1
- MFC15H10O5
- MW270.24
- EINECS678-034-6
- MOL File964-68-1.mol
Chemical Properties
| Melting point | 365°C |
| Boiling point | 373.35°C (rough estimate) |
| Density | 1.3280 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.37±0.10(Predicted) |
| color | White to Light yellow to Green |
| InChI | InChI=1S/C15H10O5/c16-13(9-1-5-11(6-2-9)14(17)18)10-3-7-12(8-4-10)15(19)20/h1-8H,(H,17,18)(H,19,20) |
| InChIKey | LFEWXDOYPCWFHR-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(C=C1)C(O)=O)(C1=CC=C(C=C1)C(O)=O)=O |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 29173990 |
