1,5,5-Trimethylhydantoin
- Product Name1,5,5-Trimethylhydantoin
- CAS6851-81-6
- MFC6H10N2O2
- MW142.16
- EINECS229-945-9
- MOL File6851-81-6.mol
Chemical Properties
| Melting point | 161-164 °C (lit.) |
| Boiling point | 259.72°C (rough estimate) |
| Density | 1.2298 (rough estimate) |
| refractive index | 1.5010 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 8.99±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C6H10N2O2/c1-6(2)4(9)7-5(10)8(6)3/h1-3H3,(H,7,9,10) |
| InChIKey | ZNYIPTYJBRGSSL-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)C(C)(C)C(=O)N1 |
| CAS DataBase Reference | 6851-81-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |