3-Bromo-4-methoxyphenylacetic acid
- Product Name3-Bromo-4-methoxyphenylacetic acid
- CAS774-81-2
- MFC9H9BrO3
- MW245.07
- EINECS
- MOL File774-81-2.mol
Chemical Properties
| Melting point | 115-117°C |
| Boiling point | 361.1±27.0 °C(Predicted) |
| Density | 1.560±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.27±0.10(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C9H9BrO3/c1-13-8-3-2-6(4-7(8)10)5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
| InChIKey | POTVGQUUEQTPNA-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=C(OC)C(Br)=C1 |
| CAS DataBase Reference | 774-81-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3077 9/PG III |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 2918999090 |
