4-Acetamido-2-methylacetophenone
- Product Name4-Acetamido-2-methylacetophenone
- CAS34956-31-5
- MFC11H13NO2
- MW191.23
- EINECS233-305-4
- MOL File34956-31-5.mol
Chemical Properties
| Melting point | 137-140 °C(lit.) |
| Boiling point | 385℃ |
| Density | 1.122 |
| Flash point | 167℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.60±0.70(Predicted) |
| color | White to Light yellow |
| InChI | 1S/C11H13NO2/c1-7-6-10(12-9(3)14)4-5-11(7)8(2)13/h4-6H,1-3H3,(H,12,14) |
| InChIKey | PTARWPNYVATTDE-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(C(C)=O)c(C)c1 |
| CAS DataBase Reference | 34956-31-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |