alpha-Hydroxyalprazolam
- Product Namealpha-Hydroxyalprazolam
- CAS37115-43-8
- MFC17H13ClN4O
- MW324.76
- EINECS636-833-7
- MOL File37115-43-8.mol
Chemical Properties
| Melting point | 129-134°C |
| Flash point | 9℃ |
| storage temp. | -20°C Freezer |
| solubility | methylene chloride: ~20 mg/mL, clear, colorless to faintly yellow |
| form | powder |
| color | white to off-white |
| Major Application | clinical testing |
| InChI | 1S/C17H13ClN4O/c18-12-6-7-14-13(8-12)17(11-4-2-1-3-5-11)19-9-15-20-21-16(10-23)22(14)15/h1-8,23H,9-10H2 |
| InChIKey | ZURUZYHEEMDQBU-UHFFFAOYSA-N |
| SMILES | OCc1nnc2CN=C(c3ccccc3)c4cc(Cl)ccc4-n12 |
Safety Information
| Hazard Codes | Xn,T,F |
| Risk Statements | 20/21/22-39/23/24/25-23/24/25-11 |
| Safety Statements | 36-45-36/37-16-7 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |