exo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride
- Product Nameexo-3,6-Epoxy-1,2,3,6-tetrahydrophthalic anhydride
- CAS6118-51-0
- MFC8H6O4
- MW166.13
- EINECS629-406-1
- MOL File6118-51-0.mol
Chemical Properties
| Melting point | 118 °C (dec.)(lit.) |
| Boiling point | 372.0±42.0 °C(Predicted) |
| Density | 1.540±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Hydrolyzes in water. |
| Sensitive | Moisture Sensitive |
| BRN | 10355 |
| InChI | 1S/C8H6O4/c9-7-5-3-1-2-4(11-3)6(5)8(10)12-7/h1-6H/t3-,4+,5-,6+ |
| InChIKey | QQYNRBAAQFZCLF-FBXFSONDSA-N |
| SMILES | O=C1OC(=O)[C@H]2C3OC(C=C3)[C@@H]12 |
| CAS DataBase Reference | 6118-51-0 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | KC9650000 |
| F | 10-21 |
| TSCA | Yes |
| HS Code | 29322090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
