(R,S)-N-Nitrosoanatabine
- Product Name(R,S)-N-Nitrosoanatabine
- CAS71267-22-6
- MFC10H11N3O
- MW189.21
- EINECS690-329-1
- MOL File71267-22-6.mol
Chemical Properties
| Boiling point | 324.47°C (rough estimate) |
| Density | 1.1654 (rough estimate) |
| refractive index | 1.4830 (estimate) |
| Flash point | 2℃ |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 5.06±0.12(Predicted) |
| form | Oil |
| color | Pale Yellow to Brown |
| Stability | Light Sensitive |
| Major Application | forensics and toxicology |
| InChI | 1S/C10H11N3O/c14-12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2/t10-/m0/s1 |
| InChIKey | ZJOFAFWTOKDIFH-JTQLQIEISA-N |
| SMILES | N1([C@@H](CC=CC1)c2cnccc2)N=O |
| CAS DataBase Reference | 71267-22-6(CAS DataBase Reference) |
| IARC | 3 (Vol. 37, Sup 7, 89) 2007 |
Safety Information
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |