AMIMNTF2
- Product NameAMIMNTF2
- CAS655249-87-9
- MFC9H11F6N3O4S2
- MW403.31
- EINECS200-144-5
- MOL File655249-87-9.mol
Chemical Properties
| Density | 1.494 (29°C) |
| refractive index | 1.4320 to 1.4360 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C7H11N2.C2F6NO4S2/c1-3-4-9-6-5-8(2)7-9;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3,5-7H,1,4H2,2H3;/q+1;-1 |
| InChIKey | DHMWATGUEVQTIY-UHFFFAOYSA-N |
| SMILES | C(N1C=C[N+](C)=C1)C=C.S(=O)(=O)(C(F)(F)F)[N-]S(=O)(=O)C(F)(F)F |
| ECW | 4.8 V |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2935.90.7500 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 |