4-(2-Bromoacetyl)benzonitrile
- Product Name4-(2-Bromoacetyl)benzonitrile
- CAS20099-89-2
- MFC9H6BrNO
- MW224.05
- EINECS606-435-8
- MOL File20099-89-2.mol
Chemical Properties
| Melting point | 92-96 °C(lit.) |
| Boiling point | 342.4±22.0 °C(Predicted) |
| Density | 1.56±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Off-white to light yellow |
| BRN | 2087648 |
| InChI | InChI=1S/C9H6BrNO/c10-5-9(12)8-3-1-7(6-11)2-4-8/h1-4H,5H2 |
| InChIKey | LJANCPRIUMHGJE-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(CBr)=O)C=C1 |
| CAS DataBase Reference | 20099-89-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 20/21/22-34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 2928 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29269090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
