L-(-)-Ephedrine
- Product NameL-(-)-Ephedrine
- CAS492-41-1
- MFC9H13NO
- MW151.21
- EINECS207-755-7
- MOL File492-41-1.mol
Chemical Properties
| Melting point | 51-53 °C(lit.) |
| alpha | -41 º (c=7, 1M HCl) |
| Boiling point | 273.23°C (rough estimate) |
| Density | 1.0406 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | A solid |
| pka | 9.958(at 10℃) |
| optical activity | [α]20/D -41°, c =7 in 1 M HCl |
| Stability | Stable. Incompatible with strong oxidizing agents. May discolour on exposure to light. |
| InChI | 1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9-/m0/s1 |
| InChIKey | DLNKOYKMWOXYQA-CBAPKCEASA-N |
| SMILES | C[C@H](N)[C@H](O)c1ccccc1 |
| CAS DataBase Reference | 492-41-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenylpropanolamine(492-41-1) |
| EPA Substance Registry System | Benzenemethanol, .alpha.-[(1S)-1-aminoethyl]-, (.alpha.R)- (492-41-1) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | RC2275000 |
| F | 3-8-10 |
| Hazard Note | Harmful |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orl-rat: 1538 mg/kg BCFAAI 109,132,70 |