Tetrafluoro-1,4-benzoquinone
- Product NameTetrafluoro-1,4-benzoquinone
- CAS527-21-9
- MFC6F4O2
- MW180.06
- EINECS208-411-9
- MOL File527-21-9.mol
Chemical Properties
| Melting point | 183-186 °C (subl.) (lit.) |
| Boiling point | 133.1±40.0 °C(Predicted) |
| Density | 1.6138 (estimate) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | Light yellow to Brown |
| BRN | 1875039 |
| Stability | Stable. Non-flammable. Incompatible with strong oxidizing agents, alkali metals, strong reducing agents. |
| InChI | 1S/C6F4O2/c7-1-2(8)6(12)4(10)3(9)5(1)11 |
| InChIKey | JKLYZOGJWVAIQS-UHFFFAOYSA-N |
| SMILES | FC1=C(F)C(=O)C(F)=C(F)C1=O |
| CAS DataBase Reference | 527-21-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |