TRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE
- Product NameTRANS,TRANS-1,4-DIPHENYL-1,3-BUTADIENE
- CAS538-81-8
- MFC16H14
- MW206.28
- EINECS629-554-7
- MOL File538-81-8.mol
Chemical Properties
| Melting point | 150-152 °C(lit.) |
| Boiling point | 350 °C(lit.) |
| Density | 1.151 g/cm3 |
| refractive index | 1.5000 (estimate) |
| Flash point | 350°C/720mm |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystals or Crystalline Powder |
| color | White to slightly yellow |
| Water Solubility | Slightly soluble in water. |
| Merck | 14,3320 |
| BRN | 1905937 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C16H14/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-14H/b13-7+,14-8+ |
| InChIKey | JFLKFZNIIQFQBS-FNCQTZNRSA-N |
| SMILES | C(/C1=CC=CC=C1)=C\C=C\C1=CC=CC=C1 |
| CAS DataBase Reference | 538-81-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | Yes |
| HS Code | 29029000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
