| Melting point |
32-34 |
| Boiling point |
274℃ |
| Density |
1.1499 g/cm3 (32.5 ºC) |
| refractive index |
1.5830 (estimate) |
| storage temp. |
Room Temperature |
| solubility |
Chloroform, DMSO (Sparingly), Methanol (Slightly) |
| color |
White to Pale Yellow |
| Water Solubility |
7.8mg/L(25 ºC) |
| BRN |
1907934 |
| Henry's Law Constant |
3.0×10-2 mol/(m3Pa) at 25℃, Lau et al. (2006) |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C12H9Cl/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H |
| InChIKey |
LAXBNTIAOJWAOP-UHFFFAOYSA-N |
| SMILES |
C1(C2=CC=CC=C2)=CC=CC=C1Cl |
| CAS DataBase Reference |
2051-60-7(CAS DataBase Reference) |
| EPA Substance Registry System |
2-Chlorobiphenyl (2051-60-7) |
