4-Methoxybenzyl-2,2,2-trichloroacetimid&
- Product Name4-Methoxybenzyl-2,2,2-trichloroacetimid&
- CAS89238-99-3
- MFC10H10Cl3NO2
- MW282.55
- EINECS
- MOL File89238-99-3.mol
Chemical Properties
| Boiling point | 137 °C / 0.7mmHg |
| Density | 1.361 g/mL at 25 °C |
| refractive index | n20/D 1.5488 |
| Flash point | 110 °C |
| storage temp. | 2-8°C |
| pka | 1.96±0.70(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H10Cl3NO2/c1-15-8-4-2-7(3-5-8)6-16-9(14)10(11,12)13/h2-5,14H,6H2,1H3 |
| InChIKey | TYHGKLBJBHACOI-UHFFFAOYSA-N |
| SMILES | C(=N)(OCC1=CC=C(OC)C=C1)C(Cl)(Cl)Cl |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 20/21/22-36/37/38-51/53 |
| Safety Statements | 26-61-36/37 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |