3,5-Bis(trifluoromethyl)phenylacetylene
- Product Name3,5-Bis(trifluoromethyl)phenylacetylene
- CAS88444-81-9
- MFC10H4F6
- MW238.13
- EINECS
- MOL File88444-81-9.mol
Chemical Properties
| Boiling point | 147-148 °C (lit.) |
| Density | 1.346 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 112 °F |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C10H4F6/c1-2-6-3-7(9(11,12)13)5-8(4-6)10(14,15)16/h1,3-5H |
| InChIKey | MAHIBRPXUPUAIF-UHFFFAOYSA-N |
| SMILES | C1(C#C)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 88444-81-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |