2,3,5,6-Tetramethyl-1,4-phenylenediamine
- Product Name2,3,5,6-Tetramethyl-1,4-phenylenediamine
- CAS3102-87-2
- MFC10H16N2
- MW164.25
- EINECS221-457-4
- MOL File3102-87-2.mol
Chemical Properties
| Melting point | 150-155 °C(lit.) |
| Boiling point | 281.73°C (rough estimate) |
| Density | 1.0244 (rough estimate) |
| refractive index | 1.5700 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 6.11±0.10(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2208743 |
| InChI | InChI=1S/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
| InChIKey | WCZNKVPCIFMXEQ-UHFFFAOYSA-N |
| SMILES | C1(N)=C(C)C(C)=C(N)C(C)=C1C |
| CAS DataBase Reference | 3102-87-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-36-22 |
| WGK Germany | 3 |
| RTECS | CZ1599700 |
| HS Code | 29215190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |