4-(2'-Pyridylazo)-resorcinol free acid
- Product Name4-(2'-Pyridylazo)-resorcinol free acid
- CAS1141-59-9
- MFC11H9N3O2
- MW215.21
- EINECS214-528-6
- MOL File1141-59-9.mol
Chemical Properties
| Melting point | 192-202 °C(lit.) |
| Boiling point | 355.48°C (rough estimate) |
| Density | 1.2579 (rough estimate) |
| refractive index | 1.4930 (estimate) |
| storage temp. | room temp |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 8.18±0.35(Predicted) |
| color | Orange |
| Water Solubility | Soluble in water (partly), and ethanol (slightly). Insoluble in ether, and low-polarity solvents. |
| BRN | 184665 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C11H9N3O2/c15-8-4-5-9(10(16)7-8)13-14-11-3-1-2-6-12-11/h1-7,15-16H/b14-13+ |
| InChIKey | RJNYNDHYSJRRDW-BUHFOSPRSA-N |
| SMILES | Oc1ccc(\N=N\c2ccccn2)c(O)c1 |
| CAS DataBase Reference | 1141-59-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Benzenediol, 4-(2-pyridinylazo)- (1141-59-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
