Chemical Properties
| Melting point | 230-233 °C(Solv: ethyl ether (60-29-7); acetonitrile (75-05-8)) |
| Boiling point | 588.5±50.0 °C(Predicted) |
| Density | 1.414±0.06 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| solubility | DMSO: 4.17 mg/mL (11.41 mM; ultrasonic and warming and heat to 80°C) |
| pka | 5.13±0.20(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| InChI | 1S/C19H15N3O5/c23-19-15(9-13-1-5-17(6-2-13)21(24)25)11-20-12-16(19)10-14-3-7-18(8-4-14)22(26)27/h1-10,20H,11-12H2/b15-9+,16-10+ |
| InChIKey | YUYPWAMLWZVHAE-KAVGSWPWSA-N |
| SMILES | O=C(/C(CNC/1)=C/C2=CC=C([N+]([O-])=O)C=C2)C1=C\C3=CC=C([N+]([O-])=O)C=C3 |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
