N-Phthaloyl-DL-glutamic anhydride
- Product NameN-Phthaloyl-DL-glutamic anhydride
- CAS3343-28-0
- MFC13H9NO5
- MW259.21
- EINECS222-088-1
- MOL File3343-28-0.mol
Chemical Properties
| Melting point | 197-201 °C(lit.) |
| Boiling point | 402.47°C (rough estimate) |
| Density | 1.3394 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| solubility | soluble in Dioxane |
| form | powder to crystal |
| pka | -2.60±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C13H9NO5/c15-10-6-5-9(13(18)19-10)14-11(16)7-3-1-2-4-8(7)12(14)17/h1-4,9H,5-6H2 |
| InChIKey | ICDLEMPZXFCQEB-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1C1CCC(=O)OC1=O |
| CAS DataBase Reference | 3343-28-0 |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(tetrahydro-2,6-dioxo-2H-pyran-3-yl)- (3343-28-0) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38-40 |
| Safety Statements | 23-26-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | MA3900000 |
| TSCA | TSCA listed |
| HS Code | 2925.19.4200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
