1-Phenyl-d5-AZO-2-naphthol
- Product Name1-Phenyl-d5-AZO-2-naphthol
- CAS752211-63-5
- MFC16H7D5N2O
- MW253.31
- EINECS688-238-7
- MOL File752211-63-5.mol
Chemical Properties
| Melting point | 131-133°C |
| Boiling point | 443.653±28.00 °C(Press: 760.00 Torr)(predicted) |
| Density | 1.175±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) |
| Flash point | 2 °C |
| storage temp. | Amber Vial, Refrigerator, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Hexane (Slightly) |
| form | Solid |
| pka | 13.500±0.40(predicted) |
| color | Orange to red |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/C16H12N2O/c19-15-11-10-12-6-4-5-9-14(12)16(15)18-17-13-7-2-1-3-8-13/h1-11,19H/b18-17+/i1D,2D,3D,7D,8D |
| InChIKey | MRQIXHXHHPWVIL-BWDNVODCSA-N |
| SMILES | [2H]c1c([2H])c([2H])c(\N=N\c2c(O)ccc3ccccc23)c([2H])c1[2H] |
Safety Information
| Hazard Codes | F,Xn |
| Risk Statements | 11-20/21/22-36-68-53-43-40 |
| Safety Statements | 26-36/37-16 |
| RIDADR | UN1648 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 4 Carc. 2 Muta. 2 Skin Sens. 1 |