N-Trimethoxysilylpropyl-N,N,N-trimethylammonium chloride
- Product NameN-Trimethoxysilylpropyl-N,N,N-trimethylammonium chloride
- CAS35141-36-7
- MFC9H24ClNO3Si
- MW257.83
- EINECS252-393-5
- MOL File35141-36-7.mol
Chemical Properties
| Melting point | <0°C |
| Boiling point | 68°C |
| Density | 0.927 |
| refractive index | 1.3966 |
| Flash point | 11°C |
| solubility | soluble in Chloroform, Methanol |
| form | clear liquid |
| Specific Gravity | 0.927 |
| color | Colorless to Light yellow |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Sensitive | Hygroscopic |
| Exposure limits | ACGIH: TWA 200 ppm; STEL 250 ppm (Skin) OSHA: TWA 200 ppm(260 mg/m3) NIOSH: IDLH 6000 ppm; TWA 200 ppm(260 mg/m3); STEL 250 ppm(325 mg/m3) |
| InChI | InChI=1S/C9H24NO3Si.ClH/c1-10(2,3)8-7-9-14(11-4,12-5)13-6;/h7-9H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | FYZFRYWTMMVDLR-UHFFFAOYSA-M |
| SMILES | [Si](OC)(OC)(OC)CCC[N+](C)(C)C.[Cl-] |
| CAS DataBase Reference | 35141-36-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Propanaminium, N,N,N-trimethyl-3-(trimethoxysilyl)-, chloride (35141-36-7) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 11-23/24/25-36/37/38-20/21/22-51/53-39/23/24/25 |
| Safety Statements | 7-16-36/37/39-45-36-26-61-36/37 |
| RIDADR | 1992 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |