2-Chloro-5-fluoronitrobenzene
- Product Name2-Chloro-5-fluoronitrobenzene
- CAS345-17-5
- MFC6H3ClFNO2
- MW175.54
- EINECS206-456-9
- MOL File345-17-5.mol
Chemical Properties
| Melting point | 37-40 °C (lit.) |
| Boiling point | 238 °C (lit.) |
| Density | 1.5019 (estimate) |
| Flash point | 229 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| color | Light yellow to Yellow to Orange |
| BRN | 2094191 |
| InChI | 1S/C6H3ClFNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
| InChIKey | DVXDJQKEEKXJBW-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cc(F)ccc1Cl |
| CAS DataBase Reference | 345-17-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
