Trimethyl 1,2,4-benzenetricarboxylate
- Product NameTrimethyl 1,2,4-benzenetricarboxylate
- CAS2459-10-1
- MFC12H12O6
- MW252.22
- EINECS219-547-3
- MOL File2459-10-1.mol
Chemical Properties
| Melting point | 38-40 °C (lit.) |
| Boiling point | 194 °C/12 mmHg (lit.) |
| Density | 1.261 g/mL at 25 °C (lit.) |
| vapor pressure | 0.01 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point | >230 °F |
| solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Water Solubility | 1.11g/L at 20℃ |
| InChI | 1S/C12H12O6/c1-16-10(13)7-4-5-8(11(14)17-2)9(6-7)12(15)18-3/h4-6H,1-3H3 |
| InChIKey | MJHNUUNSCNRGJE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(c1)C(=O)OC |
| LogP | 1.96 at 25℃ |
| CAS DataBase Reference | 2459-10-1(CAS DataBase Reference) |
| EPA Substance Registry System | Trimethyl trimellitate (2459-10-1) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
| Hazardous Substances Data | 2459-10-1(Hazardous Substances Data) |
