3-(2-PYRIDYL)-5,6-DIPHENYL-1,2,4-TRIAZINE
- Product Name3-(2-PYRIDYL)-5,6-DIPHENYL-1,2,4-TRIAZINE
- CAS1046-56-6
- MFC20H14N4
- MW310.35
- EINECS213-878-7
- MOL File1046-56-6.mol
Chemical Properties
| Melting point | 191-193 °C (lit.) |
| Boiling point | 440.52°C (rough estimate) |
| Density | 1.2028 (rough estimate) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | -0.06±0.63(Predicted) |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Soluble in water. |
| BRN | 542151 |
| Stability | Stable. Incompatible with strong acids, strong oxidizing agents. |
| InChI | 1S/C20H14N4/c1-3-9-15(10-4-1)18-19(16-11-5-2-6-12-16)23-24-20(22-18)17-13-7-8-14-21-17/h1-14H |
| InChIKey | OTMYLOBWDNFTLO-UHFFFAOYSA-N |
| SMILES | c1ccc(cc1)-c2nnc(nc2-c3ccccc3)-c4ccccn4 |
| CAS DataBase Reference | 1046-56-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,4-Triazine, 5,6-diphenyl-3-(2-pyridinyl)- (1046-56-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | XY8598150 |
| TSCA | TSCA listed |
| HS Code | 29336990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |