N-(5-Bromopentyl)phthalimide
- Product NameN-(5-Bromopentyl)phthalimide
- CAS954-81-4
- MFC13H14BrNO2
- MW296.16
- EINECS674-061-2
- MOL File954-81-4.mol
Chemical Properties
| Melting point | 58 °C |
| Boiling point | 393.1±25.0 °C(Predicted) |
| Density | 1.459±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -2.13±0.20(Predicted) |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| λmax | 295nm(EtOH)(lit.) |
| BRN | 177015 |
| InChI | 1S/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| InChIKey | QKVHAKICMNABGB-UHFFFAOYSA-N |
| SMILES | BrCCCCCN1C(=O)c2ccccc2C1=O |
| CAS DataBase Reference | 954-81-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N,Xn |
| Risk Statements | 36/37/38-50/53-43-22 |
| Safety Statements | 26-36/37/39-61-60-36/37 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |