N-Carbobenzoxy-4-oxo-L-proline
- Product NameN-Carbobenzoxy-4-oxo-L-proline
- CAS64187-47-9
- MFC13H13NO5
- MW263.25
- EINECS
- MOL File64187-47-9.mol
Chemical Properties
| Melting point | 95℃ |
| Boiling point | 488.5±45.0 °C(Predicted) |
| Density | 1.408±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 3.83±0.20(Predicted) |
| color | White to yellow to brown |
| optical activity | [α]22/D +6.0°, c = 1 in chloroform |
| Major Application | peptide synthesis |
| InChI | 1S/C13H13NO5/c15-10-6-11(12(16)17)14(7-10)13(18)19-8-9-4-2-1-3-5-9/h1-5,11H,6-8H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | RPLLCMZOIFOBIF-NSHDSACASA-N |
| SMILES | OC(=O)[C@@H]1CC(=O)CN1C(=O)OCc2ccccc2 |
| CAS DataBase Reference | 64187-47-9 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |