4-Methylumbelliferone-3-acetic acid N-succinimidyl ester
- Product Name4-Methylumbelliferone-3-acetic acid N-succinimidyl ester
- CAS96735-88-5
- MFC16H13NO7
- MW331.28
- EINECS
- MOL File96735-88-5.mol
Chemical Properties
| Boiling point | 558.4±60.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | −20°C |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.80±0.20(Predicted) |
| color | White to Almost white |
| Appearance | Solid Powder |
| InChI | InChI=1S/C16H13NO7/c1-8-10-3-2-9(18)6-12(10)23-16(22)11(8)7-15(21)24-17-13(19)4-5-14(17)20/h2-3,6,18H,4-5,7H2,1H3 |
| InChIKey | VODLZKHEKKGCBG-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C(C)=C1CC(ON1C(=O)CCC1=O)=O |
| CAS DataBase Reference | 96735-88-5 |
Safety Information
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 2934.99.4400 |
