(1S,2S)-1,2-Cyclohexanedicarboxylic acid
- Product Name(1S,2S)-1,2-Cyclohexanedicarboxylic acid
- CAS21963-41-7
- MFC8H12O4
- MW172.18
- EINECS
- MOL File21963-41-7.mol
Chemical Properties
| Melting point | 184 °C |
| Boiling point | 384.1±35.0 °C(Predicted) |
| Density | 1.314 |
| refractive index | 18 ° (C=1, Acetone) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in acetone(almost transparency). |
| form | powder to crystal |
| pka | 4.18±0.28(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6-/m0/s1 |
| InChIKey | QSAWQNUELGIYBC-WDSKDSINSA-N |
| SMILES | [C@H]1(C(O)=O)CCCC[C@@H]1C(O)=O |
| CAS DataBase Reference | 21963-41-7 |